C36H62NOSi3Y+2 — CID 11366011
CID 11366011 (PubChem CID 11366011) has the molecular formula C36H62NOSi3Y+2 and a molecular weight of 698.06 g/mol.
| Compound Name | CID 11366011 |
|---|---|
| PubChem CID | 11366011 |
| Molecular Formula | C36H62NOSi3Y+2 |
| Molecular Weight | 698.06 g/mol |
| Exact Mass | 697.32 |
| IUPAC Name | — |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C]1[CH][CH][C]([Si](C)(C)[C]2[C]3CCCC[C]3[C]3CCCC[C]32)[CH]1.C[Si](C)(C)[N-][Si](C)(C)C.[Y+3] |
| InChI | InChI=1S/C30H44OSi.C6H18NSi2.Y/c1-20(2)24-17-14-21(3)18-29(24)31-22-15-16-23(19-22)32(4,5)30-27-12-8-6-10-25(27)26-11-7-9-13-28(26)30;1-8(2,3)7-9(4,5)6;/h15-16,19-21,24,29H,6-14,17-18H2,1-5H3;1-6H3;/q;-1;+3/t21-,24+,29-;;/m1../s1 |
| InChIKey | JFXSBVQYFVHLIS-AXIREMBBSA-N |
| XLogP | 11.05 |
| TPSA | 23.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.06 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|