C33H59NdSi3- — CID 134902983
CID 134902983 (PubChem CID 134902983) has the molecular formula C33H59NdSi3- and a molecular weight of 684.33 g/mol.
| Compound Name | CID 134902983 |
|---|---|
| PubChem CID | 134902983 |
| Molecular Formula | C33H59NdSi3- |
| Molecular Weight | 684.33 g/mol |
| Exact Mass | 681.30 |
| IUPAC Name | — |
| SMILES | C[C]1[C](C)[C](C)[C]([Si](C)(C)[C]2[CH][CH][C]([C@H]3C[C@H](C)CC[C@H]3C(C)C)[CH]2)[C]1C.C[Si](C)(C)[CH-][Si](C)(C)C.[Nd] |
| InChI | InChI=1S/C26H40Si.C7H19Si2.Nd/c1-16(2)24-13-10-17(3)14-25(24)22-11-12-23(15-22)27(8,9)26-20(6)18(4)19(5)21(26)7;1-8(2,3)7-9(4,5)6;/h11-12,15-17,24-25H,10,13-14H2,1-9H3;7H,1-6H3;/q;-1;/t17-,24+,25-;;/m1../s1 |
| InChIKey | JAJODRXDICEXPZ-ZNNKJPQYSA-N |
| XLogP | 10.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.33 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|