C24H34F2O3 — CID 143889426
5-[[4-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]methoxy]-2-pentyloxane (PubChem CID 143889426) has the molecular formula C24H34F2O3 and a molecular weight of 408.53 g/mol. Its IUPAC name is 5-[[4-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]methoxy]-2-pentyloxane.
| Compound Name | 5-[[4-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]methoxy]-2-pentyloxane |
|---|---|
| PubChem CID | 143889426 |
| Molecular Formula | C24H34F2O3 |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 5-[[4-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)cyclohexa-1,3-dien-1-yl]methoxy]-2-pentyloxane |
| SMILES | CCCCCC1CCC(OCC2=CC=C(C3=C(F)C(F)=C(OC)CC3)CC2)CO1 |
| InChI | InChI=1S/C24H34F2O3/c1-3-4-5-6-19-11-12-20(16-29-19)28-15-17-7-9-18(10-8-17)21-13-14-22(27-2)24(26)23(21)25/h7,9,19-20H,3-6,8,10-16H2,1-2H3 |
| InChIKey | MKLFOJJLCCDMHJ-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|