C22H34F2O3 — CID 143889343
2-(4-ethenylcyclohexyl)-5-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]oxane (PubChem CID 143889343) has the molecular formula C22H34F2O3 and a molecular weight of 384.51 g/mol. Its IUPAC name is 2-(4-ethenylcyclohexyl)-5-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]oxane.
| Compound Name | 2-(4-ethenylcyclohexyl)-5-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]oxane |
|---|---|
| PubChem CID | 143889343 |
| Molecular Formula | C22H34F2O3 |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 2-(4-ethenylcyclohexyl)-5-[(2Z,4Z)-2-ethyl-3,4-difluoro-5-methoxyhexa-2,4-dienoxy]oxane |
| SMILES | C=CC1CCC(C2CCC(OC/C(CC)=C(F)/C(F)=C(\C)OC)CO2)CC1 |
| InChI | InChI=1S/C22H34F2O3/c1-5-16-7-9-18(10-8-16)20-12-11-19(14-27-20)26-13-17(6-2)22(24)21(23)15(3)25-4/h5,16,18-20H,1,6-14H2,2-4H3/b21-15-,22-17- |
| InChIKey | XSYRVFIZPRWWMU-MTZWUWKKSA-N |
| XLogP | 6.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|