C30H39F3O2 — CID 88953670
3-[(3Z,5E,7Z,9Z)-9-(4-ethenylcyclohexyl)-7,8-difluoro-6-methylidene-5-prop-2-enylideneundeca-3,7,9-trienoxy]-1-fluoro-6-methoxycyclohexene (PubChem CID 88953670) has the molecular formula C30H39F3O2 and a molecular weight of 488.63 g/mol. Its IUPAC name is 3-[(3Z,5E,7Z,9Z)-9-(4-ethenylcyclohexyl)-7,8-difluoro-6-methylidene-5-prop-2-enylideneundeca-3,7,9-trienoxy]-1-fluoro-6-methoxycyclohexene.
| Compound Name | 3-[(3Z,5E,7Z,9Z)-9-(4-ethenylcyclohexyl)-7,8-difluoro-6-methylidene-5-prop-2-enylideneundeca-3,7,9-trienoxy]-1-fluoro-6-methoxycyclohexene |
|---|---|
| PubChem CID | 88953670 |
| Molecular Formula | C30H39F3O2 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | 3-[(3Z,5E,7Z,9Z)-9-(4-ethenylcyclohexyl)-7,8-difluoro-6-methylidene-5-prop-2-enylideneundeca-3,7,9-trienoxy]-1-fluoro-6-methoxycyclohexene |
| SMILES | C=C/C=C(\C=C/CCOC1C=C(F)C(OC)CC1)C(=C)/C(F)=C(F)\C(=C/C)C1CCC(C=C)CC1 |
| InChI | InChI=1S/C30H39F3O2/c1-6-11-23(12-9-10-19-35-25-17-18-28(34-5)27(31)20-25)21(4)29(32)30(33)26(8-3)24-15-13-22(7-2)14-16-24/h6-9,11-12,20,22,24-25,28H,1-2,4,10,13-19H2,3,5H3/b12-9-,23-11+,26-8-,30-29- |
| InChIKey | VIPYHPGSVXEVOG-OBLIZEOLSA-N |
| XLogP | 8.74 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|