C26H42F2O3 — CID 143889248
5-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-2-pentyloxane (PubChem CID 143889248) has the molecular formula C26H42F2O3 and a molecular weight of 440.62 g/mol. Its IUPAC name is 5-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-2-pentyloxane.
| Compound Name | 5-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-2-pentyloxane |
|---|---|
| PubChem CID | 143889248 |
| Molecular Formula | C26H42F2O3 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | 5-[(2E,4E,6Z,8Z)-2,6-diethyl-7,8-difluoro-9-methoxy-5-methyldeca-2,4,6,8-tetraenoxy]-2-pentyloxane |
| SMILES | CCCCCC1CCC(OC/C(=C/C=C(C)/C(CC)=C(F)/C(F)=C(\C)OC)CC)CO1 |
| InChI | InChI=1S/C26H42F2O3/c1-7-10-11-12-22-15-16-23(18-31-22)30-17-21(8-2)14-13-19(4)24(9-3)26(28)25(27)20(5)29-6/h13-14,22-23H,7-12,15-18H2,1-6H3/b19-13+,21-14+,25-20-,26-24- |
| InChIKey | PZJORBUVBQHNDR-KGDDFXJSSA-N |
| XLogP | 7.89 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|