C21H32F2O3 — CID 143889667
5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)-2-methylhexoxy]-2-ethenyloxane (PubChem CID 143889667) has the molecular formula C21H32F2O3 and a molecular weight of 370.48 g/mol. Its IUPAC name is 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)-2-methylhexoxy]-2-ethenyloxane.
| Compound Name | 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)-2-methylhexoxy]-2-ethenyloxane |
|---|---|
| PubChem CID | 143889667 |
| Molecular Formula | C21H32F2O3 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 5-[5-(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)-2-methylhexoxy]-2-ethenyloxane |
| SMILES | C=CC1CCC(OCC(C)CCC(C)C2=C(F)C(F)=C(OC)CC2)CO1 |
| InChI | InChI=1S/C21H32F2O3/c1-5-16-8-9-17(13-26-16)25-12-14(2)6-7-15(3)18-10-11-19(24-4)21(23)20(18)22/h5,14-17H,1,6-13H2,2-4H3 |
| InChIKey | UZIANYFBPUFHLR-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|