C31H48F2O2 — CID 130281457
2-[4-[4-(4-ethoxy-5,6-difluorocyclohepta-1,3,5-trien-1-yl)cyclohexyl]cyclohexyl]-5-pentyloxane (PubChem CID 130281457) has the molecular formula C31H48F2O2 and a molecular weight of 490.72 g/mol. Its IUPAC name is 2-[4-[4-(4-ethoxy-5,6-difluorocyclohepta-1,3,5-trien-1-yl)cyclohexyl]cyclohexyl]-5-pentyloxane.
| Compound Name | 2-[4-[4-(4-ethoxy-5,6-difluorocyclohepta-1,3,5-trien-1-yl)cyclohexyl]cyclohexyl]-5-pentyloxane |
|---|---|
| PubChem CID | 130281457 |
| Molecular Formula | C31H48F2O2 |
| Molecular Weight | 490.72 g/mol |
| Exact Mass | 490.36 |
| IUPAC Name | 2-[4-[4-(4-ethoxy-5,6-difluorocyclohepta-1,3,5-trien-1-yl)cyclohexyl]cyclohexyl]-5-pentyloxane |
| SMILES | CCCCCC1CCC(C2CCC(C3CCC(C4=CC=C(OCC)C(F)=C(F)C4)CC3)CC2)OC1 |
| InChI | InChI=1S/C31H48F2O2/c1-3-5-6-7-22-8-18-29(35-21-22)26-15-13-24(14-16-26)23-9-11-25(12-10-23)27-17-19-30(34-4-2)31(33)28(32)20-27/h17,19,22-26,29H,3-16,18,20-21H2,1-2H3 |
| InChIKey | DMKWXIGMYLHNOP-UHFFFAOYSA-N |
| XLogP | 9.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.72 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|