C29H48F2O — CID 20599973
5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane (PubChem CID 20599973) has the molecular formula C29H48F2O and a molecular weight of 450.70 g/mol. Its IUPAC name is 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane.
| Compound Name | 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane |
|---|---|
| PubChem CID | 20599973 |
| Molecular Formula | C29H48F2O |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.37 |
| IUPAC Name | 5-[4-[4-[4-(3,3-difluoroprop-2-enyl)cyclohexyl]cyclohexyl]butyl]-2-[(E)-pent-1-enyl]oxane |
| SMILES | CCC/C=C/C1CCC(CCCCC2CCC(C3CCC(CC=C(F)F)CC3)CC2)CO1 |
| InChI | InChI=1S/C29H48F2O/c1-2-3-4-9-28-20-14-25(22-32-28)8-6-5-7-23-10-16-26(17-11-23)27-18-12-24(13-19-27)15-21-29(30)31/h4,9,21,23-28H,2-3,5-8,10-20,22H2,1H3/b9-4+ |
| InChIKey | HQJVYQNSEADQPQ-RUDMXATFSA-N |
| XLogP | 9.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|