C14H19F3O2 — CID 177207236
(3E)-3-[2-(difluoromethoxy)prop-2-enylidene]-5-fluoro-2-methyl-4-methylidene-6-propyloxane (PubChem CID 177207236) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is (3E)-3-[2-(difluoromethoxy)prop-2-enylidene]-5-fluoro-2-methyl-4-methylidene-6-propyloxane.
| Compound Name | (3E)-3-[2-(difluoromethoxy)prop-2-enylidene]-5-fluoro-2-methyl-4-methylidene-6-propyloxane |
|---|---|
| PubChem CID | 177207236 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (3E)-3-[2-(difluoromethoxy)prop-2-enylidene]-5-fluoro-2-methyl-4-methylidene-6-propyloxane |
| SMILES | C=C(/C=C1\C(=C)C(F)C(CCC)OC1C)OC(F)F |
| InChI | InChI=1S/C14H19F3O2/c1-5-6-12-13(15)9(3)11(10(4)19-12)7-8(2)18-14(16)17/h7,10,12-14H,2-3,5-6H2,1,4H3/b11-7+ |
| InChIKey | HEBBCMIEBVBPJA-YRNVUSSQSA-N |
| XLogP | 4.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|