C18H24F6O2 — CID 121478628
1-[(4-ethoxycyclohexyl)oxy-difluoromethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene (PubChem CID 121478628) has the molecular formula C18H24F6O2 and a molecular weight of 386.38 g/mol. Its IUPAC name is 1-[(4-ethoxycyclohexyl)oxy-difluoromethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene.
| Compound Name | 1-[(4-ethoxycyclohexyl)oxy-difluoromethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 121478628 |
| Molecular Formula | C18H24F6O2 |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1-[(4-ethoxycyclohexyl)oxy-difluoromethyl]-5,5,6,6-tetrafluoro-4-propylcyclohexa-1,3-diene |
| SMILES | CCCC1=CC=C(C(F)(F)OC2CCC(OCC)CC2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C18H24F6O2/c1-3-5-12-6-11-15(17(21,22)16(12,19)20)18(23,24)26-14-9-7-13(8-10-14)25-4-2/h6,11,13-14H,3-5,7-10H2,1-2H3 |
| InChIKey | TWJZZLKRRQBWAM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|