C27H46F2O3 — CID 143889638
5-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)methoxy]-2-(4-pentylcyclohexyl)oxane;propane (PubChem CID 143889638) has the molecular formula C27H46F2O3 and a molecular weight of 456.66 g/mol. Its IUPAC name is 5-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)methoxy]-2-(4-pentylcyclohexyl)oxane;propane.
| Compound Name | 5-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)methoxy]-2-(4-pentylcyclohexyl)oxane;propane |
|---|---|
| PubChem CID | 143889638 |
| Molecular Formula | C27H46F2O3 |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.34 |
| IUPAC Name | 5-[(2,3-difluoro-4-methoxycyclohexa-1,3-dien-1-yl)methoxy]-2-(4-pentylcyclohexyl)oxane;propane |
| SMILES | CCC.CCCCCC1CCC(C2CCC(OCC3=C(F)C(F)=C(OC)CC3)CO2)CC1 |
| InChI | InChI=1S/C24H38F2O3.C3H8/c1-3-4-5-6-17-7-9-18(10-8-17)21-14-12-20(16-29-21)28-15-19-11-13-22(27-2)24(26)23(19)25;1-3-2/h17-18,20-21H,3-16H2,1-2H3;3H2,1-2H3 |
| InChIKey | GJOMLJQYVCEFHF-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|