C13H21N5O2 — CID 143892315
6-[(1S)-5-amino-2,5-diazabicyclo[2.2.1]heptan-2-yl]-N-hydroxypyridine-3-carboxamide;ethane (PubChem CID 143892315) has the molecular formula C13H21N5O2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 6-[(1S)-5-amino-2,5-diazabicyclo[2.2.1]heptan-2-yl]-N-hydroxypyridine-3-carboxamide;ethane.
| Compound Name | 6-[(1S)-5-amino-2,5-diazabicyclo[2.2.1]heptan-2-yl]-N-hydroxypyridine-3-carboxamide;ethane |
|---|---|
| PubChem CID | 143892315 |
| Molecular Formula | C13H21N5O2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 6-[(1S)-5-amino-2,5-diazabicyclo[2.2.1]heptan-2-yl]-N-hydroxypyridine-3-carboxamide;ethane |
| SMILES | CC.NN1C[C@@H]2CC1CN2c1ccc(C(=O)NO)cn1 |
| InChI | InChI=1S/C11H15N5O2.C2H6/c12-16-6-8-3-9(16)5-15(8)10-2-1-7(4-13-10)11(17)14-18;1-2/h1-2,4,8-9,18H,3,5-6,12H2,(H,14,17);1-2H3/t8-,9?;/m0./s1 |
| InChIKey | ZDTLVYVJVGZIQM-GUORDYTPSA-N |
| XLogP | 0.36 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|