C15H20N6O3 — CID 75045116
N-hydroxy-2-[5-(pyrrolidine-1-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide (PubChem CID 75045116) has the molecular formula C15H20N6O3 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-hydroxy-2-[5-(pyrrolidine-1-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[5-(pyrrolidine-1-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 75045116 |
| Molecular Formula | C15H20N6O3 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | N-hydroxy-2-[5-(pyrrolidine-1-carbonyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2CC3CC2CN3C(=O)N2CCCC2)nc1 |
| InChI | InChI=1S/C15H20N6O3/c22-13(18-24)10-6-16-14(17-7-10)20-8-12-5-11(20)9-21(12)15(23)19-3-1-2-4-19/h6-7,11-12,24H,1-5,8-9H2,(H,18,22) |
| InChIKey | VYMWXCOMJMECSQ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|