C19H22N6O3 — CID 150726812
N-hydroxy-2-[(1S,4S)-5-[3-[methyl(2-oxoethyl)amino]phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide (PubChem CID 150726812) has the molecular formula C19H22N6O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-hydroxy-2-[(1S,4S)-5-[3-[methyl(2-oxoethyl)amino]phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[(1S,4S)-5-[3-[methyl(2-oxoethyl)amino]phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 150726812 |
| Molecular Formula | C19H22N6O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | N-hydroxy-2-[(1S,4S)-5-[3-[methyl(2-oxoethyl)amino]phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
| SMILES | CN(CC=O)c1cccc(N2C[C@@H]3C[C@H]2CN3c2ncc(C(=O)NO)cn2)c1 |
| InChI | InChI=1S/C19H22N6O3/c1-23(5-6-26)14-3-2-4-15(7-14)24-11-17-8-16(24)12-25(17)19-20-9-13(10-21-19)18(27)22-28/h2-4,6-7,9-10,16-17,28H,5,8,11-12H2,1H3,(H,22,27)/t16-,17-/m0/s1 |
| InChIKey | JQZNKNVOUMIBAQ-IRXDYDNUSA-N |
| XLogP | 0.70 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|