C16H21N5O5 — CID 59783797
oxan-4-yl (1R,4R)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 59783797) has the molecular formula C16H21N5O5 and a molecular weight of 363.37 g/mol. Its IUPAC name is oxan-4-yl (1R,4R)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | oxan-4-yl (1R,4R)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 59783797 |
| Molecular Formula | C16H21N5O5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | oxan-4-yl (1R,4R)-5-[5-(hydroxycarbamoyl)pyrimidin-2-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | O=C(NO)c1cnc(N2C[C@H]3C[C@@H]2CN3C(=O)OC2CCOCC2)nc1 |
| InChI | InChI=1S/C16H21N5O5/c22-14(19-24)10-6-17-15(18-7-10)20-8-12-5-11(20)9-21(12)16(23)26-13-1-3-25-4-2-13/h6-7,11-13,24H,1-5,8-9H2,(H,19,22)/t11-,12-/m1/s1 |
| InChIKey | FQPKKUQTCDJBLQ-VXGBXAGGSA-N |
| XLogP | 0.17 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|