C17H16F3N5O2 — CID 59783770
N-hydroxy-2-[(1R,4R)-5-[4-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide (PubChem CID 59783770) has the molecular formula C17H16F3N5O2 and a molecular weight of 379.34 g/mol. Its IUPAC name is N-hydroxy-2-[(1R,4R)-5-[4-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[(1R,4R)-5-[4-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 59783770 |
| Molecular Formula | C17H16F3N5O2 |
| Molecular Weight | 379.34 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-hydroxy-2-[(1R,4R)-5-[4-(trifluoromethyl)phenyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]pyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2C[C@H]3C[C@@H]2CN3c2ccc(C(F)(F)F)cc2)nc1 |
| InChI | InChI=1S/C17H16F3N5O2/c18-17(19,20)11-1-3-12(4-2-11)24-8-14-5-13(24)9-25(14)16-21-6-10(7-22-16)15(26)23-27/h1-4,6-7,13-14,27H,5,8-9H2,(H,23,26)/t13-,14-/m1/s1 |
| InChIKey | HSAHXUAUVANYIQ-ZIAGYGMSSA-N |
| XLogP | 2.08 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|