C12H11NO2S — CID 1438926
ethyl 4-prop-2-ynylthieno[3,2-b]pyrrole-5-carboxylate (PubChem CID 1438926) has the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. Its IUPAC name is ethyl 4-prop-2-ynylthieno[3,2-b]pyrrole-5-carboxylate.
| Compound Name | ethyl 4-prop-2-ynylthieno[3,2-b]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 1438926 |
| Molecular Formula | C12H11NO2S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.05 |
| IUPAC Name | ethyl 4-prop-2-ynylthieno[3,2-b]pyrrole-5-carboxylate |
| SMILES | C#CCn1c(C(=O)OCC)cc2sccc21 |
| InChI | InChI=1S/C12H11NO2S/c1-3-6-13-9-5-7-16-11(9)8-10(13)12(14)15-4-2/h1,5,7-8H,4,6H2,2H3 |
| InChIKey | CPEIXBVOTCTLBP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|