C31H41N3O3 — CID 143893397
[(3S)-8-[3-[(2-methyl-4-pyridinyl)amino]-3-oxopropyl]-7-azaspiro[3.5]nonan-3-yl] 1-phenylcycloheptane-1-carboxylate (PubChem CID 143893397) has the molecular formula C31H41N3O3 and a molecular weight of 503.69 g/mol. Its IUPAC name is [(3S)-8-[3-[(2-methyl-4-pyridinyl)amino]-3-oxopropyl]-7-azaspiro[3.5]nonan-3-yl] 1-phenylcycloheptane-1-carboxylate.
| Compound Name | [(3S)-8-[3-[(2-methyl-4-pyridinyl)amino]-3-oxopropyl]-7-azaspiro[3.5]nonan-3-yl] 1-phenylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 143893397 |
| Molecular Formula | C31H41N3O3 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.31 |
| IUPAC Name | [(3S)-8-[3-[(2-methyl-4-pyridinyl)amino]-3-oxopropyl]-7-azaspiro[3.5]nonan-3-yl] 1-phenylcycloheptane-1-carboxylate |
| SMILES | Cc1cc(NC(=O)CCC2CC3(CCN2)CC[C@@H]3OC(=O)C2(c3ccccc3)CCCCCC2)ccn1 |
| InChI | InChI=1S/C31H41N3O3/c1-23-21-25(14-19-32-23)34-28(35)12-11-26-22-30(18-20-33-26)17-13-27(30)37-29(36)31(15-7-2-3-8-16-31)24-9-5-4-6-10-24/h4-6,9-10,14,19,21,26-27,33H,2-3,7-8,11-13,15-18,20,22H2,1H3,(H,32,34,35)/t26?,27-,30?/m0/s1 |
| InChIKey | KZRKGNGLYVTCNL-RITVZFNQSA-N |
| XLogP | 5.84 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |