C29H29N5OS — CID 143894803
(Z)-1-[(2R)-2-(3-methylphenyl)pyrrolidin-1-yl]-3-[5-[6-(4-methylsulfinylphenyl)-2-pyridinyl]-1H-imidazol-2-yl]prop-2-en-1-imine (PubChem CID 143894803) has the molecular formula C29H29N5OS and a molecular weight of 495.65 g/mol. Its IUPAC name is (Z)-1-[(2R)-2-(3-methylphenyl)pyrrolidin-1-yl]-3-[5-[6-(4-methylsulfinylphenyl)-2-pyridinyl]-1H-imidazol-2-yl]prop-2-en-1-imine.
| Compound Name | (Z)-1-[(2R)-2-(3-methylphenyl)pyrrolidin-1-yl]-3-[5-[6-(4-methylsulfinylphenyl)-2-pyridinyl]-1H-imidazol-2-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 143894803 |
| Molecular Formula | C29H29N5OS |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | (Z)-1-[(2R)-2-(3-methylphenyl)pyrrolidin-1-yl]-3-[5-[6-(4-methylsulfinylphenyl)-2-pyridinyl]-1H-imidazol-2-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C(/C=C\c1ncc(-c2cccc(-c3ccc(S(C)=O)cc3)n2)[nH]1)N1CCC[C@@H]1c1cccc(C)c1 |
| InChI | InChI=1S/C29H29N5OS/c1-20-6-3-7-22(18-20)27-10-5-17-34(27)28(30)15-16-29-31-19-26(33-29)25-9-4-8-24(32-25)21-11-13-23(14-12-21)36(2)35/h3-4,6-9,11-16,18-19,27,30H,5,10,17H2,1-2H3,(H,31,33)/b16-15-,30-28-/t27-,36?/m1/s1 |
| InChIKey | KBUQXXNMYRBQGI-XOIFPHFXSA-N |
| XLogP | 6.01 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|