C23H20FN5 — CID 137037612
3-[2-[3-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]benzonitrile (PubChem CID 137037612) has the molecular formula C23H20FN5 and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-[2-[3-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]benzonitrile.
| Compound Name | 3-[2-[3-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]benzonitrile |
|---|---|
| PubChem CID | 137037612 |
| Molecular Formula | C23H20FN5 |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | 3-[2-[3-[2-(2-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]benzonitrile |
| SMILES | [H]/N=C(\C=Cc1ncc(-c2cccc(C#N)c2)[nH]1)N1CCCC1c1ccccc1F |
| InChI | InChI=1S/C23H20FN5/c24-19-8-2-1-7-18(19)21-9-4-12-29(21)22(26)10-11-23-27-15-20(28-23)17-6-3-5-16(13-17)14-25/h1-3,5-8,10-11,13,15,21,26H,4,9,12H2,(H,27,28)/b11-10?,26-22+ |
| InChIKey | BGJLLJWACJUYQJ-WQJYKSLQSA-N |
| XLogP | 4.92 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|