C24H29FN6O2 — CID 143894865
(2S)-3-[[2-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-3,4-dihydropyridin-6-yl]amino]propane-1,2-diol (PubChem CID 143894865) has the molecular formula C24H29FN6O2 and a molecular weight of 452.53 g/mol. Its IUPAC name is (2S)-3-[[2-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-3,4-dihydropyridin-6-yl]amino]propane-1,2-diol.
| Compound Name | (2S)-3-[[2-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-3,4-dihydropyridin-6-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 143894865 |
| Molecular Formula | C24H29FN6O2 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (2S)-3-[[2-[2-[(Z)-3-[2-(3-fluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-3,4-dihydropyridin-6-yl]amino]propane-1,2-diol |
| SMILES | [H]/N=C(/C=C\c1ncc(C2=NC(NC[C@H](O)CO)=CCC2)[nH]1)N1CCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C24H29FN6O2/c25-17-5-1-4-16(12-17)21-7-3-11-31(21)22(26)9-10-24-28-14-20(30-24)19-6-2-8-23(29-19)27-13-18(33)15-32/h1,4-5,8-10,12,14,18,21,26-27,32-33H,2-3,6-7,11,13,15H2,(H,28,30)/b10-9-,26-22-/t18-,21?/m0/s1 |
| InChIKey | WLVPKOVCTYVGIP-AQCFEWGNSA-N |
| XLogP | 2.74 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|