C19H22F2N6O — CID 136628554
3-[2-[(Z)-3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-1,1-dimethylurea (PubChem CID 136628554) has the molecular formula C19H22F2N6O and a molecular weight of 388.42 g/mol. Its IUPAC name is 3-[2-[(Z)-3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(Z)-3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 136628554 |
| Molecular Formula | C19H22F2N6O |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 3-[2-[(Z)-3-[(2R)-2-(2,5-difluorophenyl)pyrrolidin-1-yl]-3-iminoprop-1-enyl]-1H-imidazol-5-yl]-1,1-dimethylurea |
| SMILES | [H]/N=C(/C=C\c1ncc(NC(=O)N(C)C)[nH]1)N1CCC[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H22F2N6O/c1-26(2)19(28)25-18-11-23-17(24-18)8-7-16(22)27-9-3-4-15(27)13-10-12(20)5-6-14(13)21/h5-8,10-11,15,22H,3-4,9H2,1-2H3,(H,23,24)(H,25,28)/b8-7-,22-16-/t15-/m1/s1 |
| InChIKey | YRMVNLZULFZJAX-BTVNDHGHSA-N |
| XLogP | 3.61 |
| TPSA | 88.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|