C19H27NO — CID 143896624
(4E,6Z)-4-ethenyl-N-methyl-3-(2-methylcyclohepta-1,3,5-trien-1-yl)oxyocta-4,6-dien-1-amine (PubChem CID 143896624) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is (4E,6Z)-4-ethenyl-N-methyl-3-(2-methylcyclohepta-1,3,5-trien-1-yl)oxyocta-4,6-dien-1-amine.
| Compound Name | (4E,6Z)-4-ethenyl-N-methyl-3-(2-methylcyclohepta-1,3,5-trien-1-yl)oxyocta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 143896624 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | (4E,6Z)-4-ethenyl-N-methyl-3-(2-methylcyclohepta-1,3,5-trien-1-yl)oxyocta-4,6-dien-1-amine |
| SMILES | C=C/C(=C\C=C/C)C(CCNC)OC1=C(C)C=CC=CC1 |
| InChI | InChI=1S/C19H27NO/c1-5-7-12-17(6-2)19(14-15-20-4)21-18-13-10-8-9-11-16(18)3/h5-12,19-20H,2,13-15H2,1,3-4H3/b7-5-,17-12+ |
| InChIKey | TWDHNFSHRPCUBZ-YQEFMUHYSA-N |
| XLogP | 4.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|