C19H29NO — CID 118535896
4-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxy-N,2-dimethylpentan-2-amine (PubChem CID 118535896) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is 4-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxy-N,2-dimethylpentan-2-amine.
| Compound Name | 4-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxy-N,2-dimethylpentan-2-amine |
|---|---|
| PubChem CID | 118535896 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | 4-[(3Z,7Z)-5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl]oxy-N,2-dimethylpentan-2-amine |
| SMILES | C=C/C=C\C(=C)C(=C)/C=C\C(=C)OC(C)CC(C)(C)NC |
| InChI | InChI=1S/C19H29NO/c1-9-10-11-15(2)16(3)12-13-17(4)21-18(5)14-19(6,7)20-8/h9-13,18,20H,1-4,14H2,5-8H3/b11-10-,13-12- |
| InChIKey | RWQXZHUXAWJWGI-FQEMRORKSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|