C18H31NO — CID 146606134
N-tert-butyl-3-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]oxycyclobutan-1-amine (PubChem CID 146606134) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is N-tert-butyl-3-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]oxycyclobutan-1-amine.
| Compound Name | N-tert-butyl-3-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]oxycyclobutan-1-amine |
|---|---|
| PubChem CID | 146606134 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | N-tert-butyl-3-[(3Z,5Z)-4-propan-2-ylhepta-1,3,5-trien-2-yl]oxycyclobutan-1-amine |
| SMILES | C=C(/C=C(\C=C/C)C(C)C)OC1CC(NC(C)(C)C)C1 |
| InChI | InChI=1S/C18H31NO/c1-8-9-15(13(2)3)10-14(4)20-17-11-16(12-17)19-18(5,6)7/h8-10,13,16-17,19H,4,11-12H2,1-3,5-7H3/b9-8-,15-10+ |
| InChIKey | VPHDTLAQUCOBGB-ABRUBGJPSA-N |
| XLogP | 4.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|