C9H16N2 — CID 155407635
(1Z,3Z)-N-(methylideneamino)-2-propan-2-ylpenta-1,3-dien-1-amine (PubChem CID 155407635) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (1Z,3Z)-N-(methylideneamino)-2-propan-2-ylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-N-(methylideneamino)-2-propan-2-ylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155407635 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1Z,3Z)-N-(methylideneamino)-2-propan-2-ylpenta-1,3-dien-1-amine |
| SMILES | C=NN/C=C(\C=C/C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-5-6-9(8(2)3)7-11-10-4/h5-8,11H,4H2,1-3H3/b6-5-,9-7+ |
| InChIKey | HWPFZJMSYNYLFT-BZWSEGBZSA-N |
| XLogP | 2.31 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|