C17H33NO — CID 143792048
N-methyl-3-[(2Z)-2-propan-2-ylpenta-2,4-dienoxy]pentan-1-amine;prop-1-ene (PubChem CID 143792048) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is N-methyl-3-[(2Z)-2-propan-2-ylpenta-2,4-dienoxy]pentan-1-amine;prop-1-ene.
| Compound Name | N-methyl-3-[(2Z)-2-propan-2-ylpenta-2,4-dienoxy]pentan-1-amine;prop-1-ene |
|---|---|
| PubChem CID | 143792048 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | N-methyl-3-[(2Z)-2-propan-2-ylpenta-2,4-dienoxy]pentan-1-amine;prop-1-ene |
| SMILES | C=C/C=C(\COC(CC)CCNC)C(C)C.C=CC |
| InChI | InChI=1S/C14H27NO.C3H6/c1-6-8-13(12(3)4)11-16-14(7-2)9-10-15-5;1-3-2/h6,8,12,14-15H,1,7,9-11H2,2-5H3;3H,1H2,2H3/b13-8+; |
| InChIKey | YGMHNNMAZGBIHU-FNXZNAJJSA-N |
| XLogP | 4.35 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|