C17H33NO — CID 163805911
(Z,3E)-3-(2-butan-2-yloxyethylidene)-2-ethyl-7-methyloct-4-en-1-amine (PubChem CID 163805911) has the molecular formula C17H33NO and a molecular weight of 267.46 g/mol. Its IUPAC name is (Z,3E)-3-(2-butan-2-yloxyethylidene)-2-ethyl-7-methyloct-4-en-1-amine.
| Compound Name | (Z,3E)-3-(2-butan-2-yloxyethylidene)-2-ethyl-7-methyloct-4-en-1-amine |
|---|---|
| PubChem CID | 163805911 |
| Molecular Formula | C17H33NO |
| Molecular Weight | 267.46 g/mol |
| Exact Mass | 267.26 |
| IUPAC Name | (Z,3E)-3-(2-butan-2-yloxyethylidene)-2-ethyl-7-methyloct-4-en-1-amine |
| SMILES | CCC(C)OC/C=C(\C=C/CC(C)C)C(CC)CN |
| InChI | InChI=1S/C17H33NO/c1-6-15(5)19-12-11-17(16(7-2)13-18)10-8-9-14(3)4/h8,10-11,14-16H,6-7,9,12-13,18H2,1-5H3/b10-8-,17-11+ |
| InChIKey | NJAGAOFACKRJKL-NERVOECZSA-N |
| XLogP | 4.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|