C16H33NO — CID 142407620
ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxyethanamine (PubChem CID 142407620) has the molecular formula C16H33NO and a molecular weight of 255.45 g/mol. Its IUPAC name is ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxyethanamine.
| Compound Name | ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxyethanamine |
|---|---|
| PubChem CID | 142407620 |
| Molecular Formula | C16H33NO |
| Molecular Weight | 255.45 g/mol |
| Exact Mass | 255.26 |
| IUPAC Name | ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxyethanamine |
| SMILES | C=C(/C=C(\C=C/C)CCC)OCCN.CC.CC |
| InChI | InChI=1S/C12H21NO.2C2H6/c1-4-6-12(7-5-2)10-11(3)14-9-8-13;2*1-2/h4,6,10H,3,5,7-9,13H2,1-2H3;2*1-2H3/b6-4-,12-10+;; |
| InChIKey | CFDKSPTXGVETCV-NSADEVMJSA-N |
| XLogP | 4.83 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|