C15H29NO — CID 142390425
ethane;2-[(3E,5E)-4-ethenylhepta-1,3,5-trien-2-yl]oxyethanamine (PubChem CID 142390425) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is ethane;2-[(3E,5E)-4-ethenylhepta-1,3,5-trien-2-yl]oxyethanamine.
| Compound Name | ethane;2-[(3E,5E)-4-ethenylhepta-1,3,5-trien-2-yl]oxyethanamine |
|---|---|
| PubChem CID | 142390425 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | ethane;2-[(3E,5E)-4-ethenylhepta-1,3,5-trien-2-yl]oxyethanamine |
| SMILES | C=CC(/C=C/C)=C\C(=C)OCCN.CC.CC |
| InChI | InChI=1S/C11H17NO.2C2H6/c1-4-6-11(5-2)9-10(3)13-8-7-12;2*1-2/h4-6,9H,2-3,7-8,12H2,1H3;2*1-2H3/b6-4+,11-9+;; |
| InChIKey | YOMXBMOHVSJVLM-GYEAHWRISA-N |
| XLogP | 4.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|