C17H35NO — CID 142368194
ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxypropan-1-amine (PubChem CID 142368194) has the molecular formula C17H35NO and a molecular weight of 269.47 g/mol. Its IUPAC name is ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxypropan-1-amine.
| Compound Name | ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 142368194 |
| Molecular Formula | C17H35NO |
| Molecular Weight | 269.47 g/mol |
| Exact Mass | 269.27 |
| IUPAC Name | ethane;2-[(3Z,5Z)-4-propylhepta-1,3,5-trien-2-yl]oxypropan-1-amine |
| SMILES | C=C(/C=C(\C=C/C)CCC)OC(C)CN.CC.CC |
| InChI | InChI=1S/C13H23NO.2C2H6/c1-5-7-13(8-6-2)9-11(3)15-12(4)10-14;2*1-2/h5,7,9,12H,3,6,8,10,14H2,1-2,4H3;2*1-2H3/b7-5-,13-9+;; |
| InChIKey | SOOKRIHAMAKRJP-QGLCFXBBSA-N |
| XLogP | 5.22 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.47 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|