C21H35NO — CID 144896590
(3Z,7Z)-2-ethoxy-10-methyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;methanamine (PubChem CID 144896590) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is (3Z,7Z)-2-ethoxy-10-methyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;methanamine.
| Compound Name | (3Z,7Z)-2-ethoxy-10-methyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;methanamine |
|---|---|
| PubChem CID | 144896590 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | (3Z,7Z)-2-ethoxy-10-methyl-5,6,9-trimethylidenetetradeca-1,3,7-triene;methanamine |
| SMILES | C=C(/C=C\C(=C)C(=C)/C=C\C(=C)C(C)CCCC)OCC.CN |
| InChI | InChI=1S/C20H30O.CH5N/c1-8-10-11-16(3)17(4)12-13-18(5)19(6)14-15-20(7)21-9-2;1-2/h12-16H,4-11H2,1-3H3;2H2,1H3/b13-12-,15-14-; |
| InChIKey | ZCDBEDAIBXKYRJ-ZABJIEAISA-N |
| XLogP | 5.72 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|