C7H13N3O3 — CID 143899674
ethane;N-hydroxy-N,3-dimethyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 143899674) has the molecular formula C7H13N3O3 and a molecular weight of 187.20 g/mol. Its IUPAC name is ethane;N-hydroxy-N,3-dimethyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | ethane;N-hydroxy-N,3-dimethyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 143899674 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | ethane;N-hydroxy-N,3-dimethyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CC.Cc1noc(C(=O)N(C)O)n1 |
| InChI | InChI=1S/C5H7N3O3.C2H6/c1-3-6-4(11-7-3)5(9)8(2)10;1-2/h10H,1-2H3;1-2H3 |
| InChIKey | MGEXRQLJQLGIGE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|