C6H9N3O3 — CID 130741804
N-ethoxy-3-methyl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 130741804) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is N-ethoxy-3-methyl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-ethoxy-3-methyl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 130741804 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | N-ethoxy-3-methyl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | CCONC(=O)c1nc(C)no1 |
| InChI | InChI=1S/C6H9N3O3/c1-3-11-9-5(10)6-7-4(2)8-12-6/h3H2,1-2H3,(H,9,10) |
| InChIKey | GNLZKTNUVJMNLG-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|