C11H11NO3S — CID 143899776
(4-methylphenyl) 2-oxo-1,3-thiazolidine-4-carboxylate (PubChem CID 143899776) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is (4-methylphenyl) 2-oxo-1,3-thiazolidine-4-carboxylate.
| Compound Name | (4-methylphenyl) 2-oxo-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 143899776 |
| Molecular Formula | C11H11NO3S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | (4-methylphenyl) 2-oxo-1,3-thiazolidine-4-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CSC(=O)N2)cc1 |
| InChI | InChI=1S/C11H11NO3S/c1-7-2-4-8(5-3-7)15-10(13)9-6-16-11(14)12-9/h2-5,9H,6H2,1H3,(H,12,14) |
| InChIKey | KDYAWWFABSSWGR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|