C18H36N2O — CID 143900110
3-N,3-N-diethyl-1-N-[(2E,4E)-4-methoxy-5-methylhepta-2,4-dien-2-yl]-1-N-methylbutane-1,3-diamine (PubChem CID 143900110) has the molecular formula C18H36N2O and a molecular weight of 296.50 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N-[(2E,4E)-4-methoxy-5-methylhepta-2,4-dien-2-yl]-1-N-methylbutane-1,3-diamine.
| Compound Name | 3-N,3-N-diethyl-1-N-[(2E,4E)-4-methoxy-5-methylhepta-2,4-dien-2-yl]-1-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 143900110 |
| Molecular Formula | C18H36N2O |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.28 |
| IUPAC Name | 3-N,3-N-diethyl-1-N-[(2E,4E)-4-methoxy-5-methylhepta-2,4-dien-2-yl]-1-N-methylbutane-1,3-diamine |
| SMILES | CC/C(C)=C(\C=C(/C)N(C)CCC(C)N(CC)CC)OC |
| InChI | InChI=1S/C18H36N2O/c1-9-15(4)18(21-8)14-17(6)19(7)13-12-16(5)20(10-2)11-3/h14,16H,9-13H2,1-8H3/b17-14+,18-15+ |
| InChIKey | IJGCERPHFBJSNO-CJQREAPYSA-N |
| XLogP | 4.27 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|