C23H27N3O4 — CID 143900816
N-[(1S)-2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-1H-indole-6-carboxamide (PubChem CID 143900816) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-1H-indole-6-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 143900816 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[(1S)-2-[(3aS,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-1H-indole-6-carboxamide |
| SMILES | CC1CN(C(=O)[C@@H](NC(=O)c2ccc3cc[nH]c3c2)C2CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C23H27N3O4/c1-13-11-26(20-18(27)12-30-21(13)20)23(29)19(15-4-2-3-5-15)25-22(28)16-7-6-14-8-9-24-17(14)10-16/h6-10,13,15,19-21,24H,2-5,11-12H2,1H3,(H,25,28)/t13?,19-,20+,21+/m0/s1 |
| InChIKey | QFZDKUXDSZJXDC-DHAXOAARSA-N |
| XLogP | 2.27 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |