C25H29N3O4S — CID 44539219
N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide (PubChem CID 44539219) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide.
| Compound Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
|---|---|
| PubChem CID | 44539219 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-4-(2-methyl-1,3-thiazol-4-yl)benzamide |
| SMILES | Cc1nc(-c2ccc(C(=O)N[C@H](C(=O)N3C[C@@H](C)[C@H]4OCC(=O)[C@H]43)C3CCCC3)cc2)cs1 |
| InChI | InChI=1S/C25H29N3O4S/c1-14-11-28(22-20(29)12-32-23(14)22)25(31)21(17-5-3-4-6-17)27-24(30)18-9-7-16(8-10-18)19-13-33-15(2)26-19/h7-10,13-14,17,21-23H,3-6,11-12H2,1-2H3,(H,27,30)/t14-,21+,22-,23-/m1/s1 |
| InChIKey | RIVPNDLCBVXTIV-ZDTCWRRLSA-N |
| XLogP | 3.22 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |