C23H27N3O5 — CID 44539316
N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 44539316) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 44539316 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N-[(1S)-2-[(3aS,6R,6aR)-6-methyl-3-oxo-3a,5,6,6a-tetrahydrofuro[3,2-b]pyrrol-4-yl]-1-cyclopentyl-2-oxoethyl]-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)[C@@H](NC(=O)c2ccc3c(c2)NC(=O)C3)C2CCCC2)[C@@H]2C(=O)CO[C@H]12 |
| InChI | InChI=1S/C23H27N3O5/c1-12-10-26(20-17(27)11-31-21(12)20)23(30)19(13-4-2-3-5-13)25-22(29)15-7-6-14-9-18(28)24-16(14)8-15/h6-8,12-13,19-21H,2-5,9-11H2,1H3,(H,24,28)(H,25,29)/t12-,19+,20-,21-/m1/s1 |
| InChIKey | OALNJRGDFLDUPA-TUQOMBBFSA-N |
| XLogP | 1.28 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |