C11H9IN4S — CID 143904335
5-amino-1-[(2E,4Z,6E)-7-iodo-1-sulfanylidenehepta-2,4,6-trien-3-yl]pyrazole-4-carbonitrile (PubChem CID 143904335) has the molecular formula C11H9IN4S and a molecular weight of 356.19 g/mol. Its IUPAC name is 5-amino-1-[(2E,4Z,6E)-7-iodo-1-sulfanylidenehepta-2,4,6-trien-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[(2E,4Z,6E)-7-iodo-1-sulfanylidenehepta-2,4,6-trien-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143904335 |
| Molecular Formula | C11H9IN4S |
| Molecular Weight | 356.19 g/mol |
| Exact Mass | 355.96 |
| IUPAC Name | 5-amino-1-[(2E,4Z,6E)-7-iodo-1-sulfanylidenehepta-2,4,6-trien-3-yl]pyrazole-4-carbonitrile |
| SMILES | N#Cc1cnn(C(/C=C\C=C\I)=C/C=S)c1N |
| InChI | InChI=1S/C11H9IN4S/c12-5-2-1-3-10(4-6-17)16-11(14)9(7-13)8-15-16/h1-6,8H,14H2/b3-1-,5-2+,10-4+ |
| InChIKey | NNYRIMQSTGDHOF-PQDUULSYSA-N |
| XLogP | 2.68 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|