C12H13IN4 — CID 143843834
5-amino-1-[(2E,4Z)-7-iodoocta-2,4,7-trien-3-yl]pyrazole-4-carbonitrile (PubChem CID 143843834) has the molecular formula C12H13IN4 and a molecular weight of 340.17 g/mol. Its IUPAC name is 5-amino-1-[(2E,4Z)-7-iodoocta-2,4,7-trien-3-yl]pyrazole-4-carbonitrile.
| Compound Name | 5-amino-1-[(2E,4Z)-7-iodoocta-2,4,7-trien-3-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143843834 |
| Molecular Formula | C12H13IN4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 5-amino-1-[(2E,4Z)-7-iodoocta-2,4,7-trien-3-yl]pyrazole-4-carbonitrile |
| SMILES | C=C(I)C/C=C\C(=C/C)n1ncc(C#N)c1N |
| InChI | InChI=1S/C12H13IN4/c1-3-11(6-4-5-9(2)13)17-12(15)10(7-14)8-16-17/h3-4,6,8H,2,5,15H2,1H3/b6-4-,11-3+ |
| InChIKey | KMERZFKUWOVAES-TYTBFOFYSA-N |
| XLogP | 3.09 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|