C15H22N4 — CID 143801577
ethane;5-(ethylamino)-1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrazole-4-carbonitrile (PubChem CID 143801577) has the molecular formula C15H22N4 and a molecular weight of 258.37 g/mol. Its IUPAC name is ethane;5-(ethylamino)-1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrazole-4-carbonitrile.
| Compound Name | ethane;5-(ethylamino)-1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 143801577 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | ethane;5-(ethylamino)-1-[(2E,4Z)-hepta-2,4,6-trien-2-yl]pyrazole-4-carbonitrile |
| SMILES | C=C/C=C\C=C(/C)n1ncc(C#N)c1NCC.CC |
| InChI | InChI=1S/C13H16N4.C2H6/c1-4-6-7-8-11(3)17-13(15-5-2)12(9-14)10-16-17;1-2/h4,6-8,10,15H,1,5H2,2-3H3;1-2H3/b7-6-,11-8+; |
| InChIKey | UFUKFPSWYPYOTF-DWROGWBBSA-N |
| XLogP | 3.82 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|