C15H10N6 — CID 91103076
2-[(4-cyano-1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)iminomethyl]propanedinitrile (PubChem CID 91103076) has the molecular formula C15H10N6 and a molecular weight of 274.29 g/mol. Its IUPAC name is 2-[(4-cyano-1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)iminomethyl]propanedinitrile.
| Compound Name | 2-[(4-cyano-1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)iminomethyl]propanedinitrile |
|---|---|
| PubChem CID | 91103076 |
| Molecular Formula | C15H10N6 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-[(4-cyano-1-cyclohepta-1,4,6-trien-1-ylpyrazol-3-yl)iminomethyl]propanedinitrile |
| SMILES | N#Cc1cn(C2=CCC=CC=C2)nc1/N=C/C(C#N)C#N |
| InChI | InChI=1S/C15H10N6/c16-7-12(8-17)10-19-15-13(9-18)11-21(20-15)14-5-3-1-2-4-6-14/h1-3,5-6,10-12H,4H2/b19-10+ |
| InChIKey | JHGXZRYFTNRRQV-VXLYETTFSA-N |
| XLogP | 2.48 |
| TPSA | 101.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|