C31H35N3O3S — CID 143905094
3-amino-5-[3-[[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid (PubChem CID 143905094) has the molecular formula C31H35N3O3S and a molecular weight of 529.71 g/mol. Its IUPAC name is 3-amino-5-[3-[[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid.
| Compound Name | 3-amino-5-[3-[[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid |
|---|---|
| PubChem CID | 143905094 |
| Molecular Formula | C31H35N3O3S |
| Molecular Weight | 529.71 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | 3-amino-5-[3-[[2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid |
| SMILES | CN(CC(O)CNC(C)(C)Cc1ccc2ccccc2c1)Sc1cccc(-c2cc(N)cc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C31H35N3O3S/c1-31(2,18-21-11-12-22-7-4-5-8-23(22)13-21)33-19-28(35)20-34(3)38-29-10-6-9-24(17-29)25-14-26(30(36)37)16-27(32)15-25/h4-17,28,33,35H,18-20,32H2,1-3H3,(H,36,37) |
| InChIKey | NMCONDMYNNLQAR-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.71 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|