C25H31BN2O3S — CID 89119202
CID 89119202 (PubChem CID 89119202) has the molecular formula C25H31BN2O3S and a molecular weight of 450.41 g/mol.
| Compound Name | CID 89119202 |
|---|---|
| PubChem CID | 89119202 |
| Molecular Formula | C25H31BN2O3S |
| Molecular Weight | 450.41 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | — |
| SMILES | [B]c1cccc(CS(=O)(=O)N(C)CC(O)CNC(C)(C)Cc2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C25H31BN2O3S/c1-25(2,15-19-11-12-21-8-4-5-9-22(21)13-19)27-16-24(29)17-28(3)32(30,31)18-20-7-6-10-23(26)14-20/h4-14,24,27,29H,15-18H2,1-3H3 |
| InChIKey | MDTFFMQGYDZSAR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|