C31H34N2O3S — CID 143905176
3-[3-[[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid (PubChem CID 143905176) has the molecular formula C31H34N2O3S and a molecular weight of 514.69 g/mol. Its IUPAC name is 3-[3-[[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid.
| Compound Name | 3-[3-[[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid |
|---|---|
| PubChem CID | 143905176 |
| Molecular Formula | C31H34N2O3S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 3-[3-[[(2R)-2-hydroxy-3-[(2-methyl-1-naphthalen-2-ylpropan-2-yl)amino]propyl]-methylamino]sulfanylphenyl]benzoic acid |
| SMILES | CN(C[C@H](O)CNC(C)(C)Cc1ccc2ccccc2c1)Sc1cccc(-c2cccc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C31H34N2O3S/c1-31(2,19-22-14-15-23-8-4-5-9-24(23)16-22)32-20-28(34)21-33(3)37-29-13-7-11-26(18-29)25-10-6-12-27(17-25)30(35)36/h4-18,28,32,34H,19-21H2,1-3H3,(H,35,36)/t28-/m1/s1 |
| InChIKey | MOSLUYZVUWOEQK-MUUNZHRXSA-N |
| XLogP | 6.12 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|