C30H40N2O2S — CID 143905429
1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-[methyl-[3-(3-propylphenyl)phenyl]sulfanylamino]propan-2-ol (PubChem CID 143905429) has the molecular formula C30H40N2O2S and a molecular weight of 492.73 g/mol. Its IUPAC name is 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-[methyl-[3-(3-propylphenyl)phenyl]sulfanylamino]propan-2-ol.
| Compound Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-[methyl-[3-(3-propylphenyl)phenyl]sulfanylamino]propan-2-ol |
|---|---|
| PubChem CID | 143905429 |
| Molecular Formula | C30H40N2O2S |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | 1-[[1-(4-methoxyphenyl)-2-methylpropan-2-yl]amino]-3-[methyl-[3-(3-propylphenyl)phenyl]sulfanylamino]propan-2-ol |
| SMILES | CCCc1cccc(-c2cccc(SN(C)CC(O)CNC(C)(C)Cc3ccc(OC)cc3)c2)c1 |
| InChI | InChI=1S/C30H40N2O2S/c1-6-9-23-10-7-11-25(18-23)26-12-8-13-29(19-26)35-32(4)22-27(33)21-31-30(2,3)20-24-14-16-28(34-5)17-15-24/h7-8,10-19,27,31,33H,6,9,20-22H2,1-5H3 |
| InChIKey | ZZAQIJIZZHYFDL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|