C24H20BrF4NS — CID 143907419
1-(4-bromo-3-fluorophenyl)sulfanyl-3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinoline (PubChem CID 143907419) has the molecular formula C24H20BrF4NS and a molecular weight of 510.39 g/mol. Its IUPAC name is 1-(4-bromo-3-fluorophenyl)sulfanyl-3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinoline.
| Compound Name | 1-(4-bromo-3-fluorophenyl)sulfanyl-3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinoline |
|---|---|
| PubChem CID | 143907419 |
| Molecular Formula | C24H20BrF4NS |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.04 |
| IUPAC Name | 1-(4-bromo-3-fluorophenyl)sulfanyl-3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinoline |
| SMILES | CC1(C)Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc2N(Sc2ccc(Br)c(F)c2)C1 |
| InChI | InChI=1S/C24H20BrF4NS/c1-23(2)13-17-11-16(15-3-6-18(7-4-15)24(27,28)29)5-10-22(17)30(14-23)31-19-8-9-20(25)21(26)12-19/h3-12H,13-14H2,1-2H3 |
| InChIKey | JSJQCABSKFZBIC-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|