C27H23ClF3N3O2 — CID 174626981
3-[2-chloro-4-[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]phenyl]-2,5-dihydro-1,2,4-oxadiazole-5-carbaldehyde (PubChem CID 174626981) has the molecular formula C27H23ClF3N3O2 and a molecular weight of 513.95 g/mol. Its IUPAC name is 3-[2-chloro-4-[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]phenyl]-2,5-dihydro-1,2,4-oxadiazole-5-carbaldehyde.
| Compound Name | 3-[2-chloro-4-[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]phenyl]-2,5-dihydro-1,2,4-oxadiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 174626981 |
| Molecular Formula | C27H23ClF3N3O2 |
| Molecular Weight | 513.95 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 3-[2-chloro-4-[3,3-dimethyl-6-[4-(trifluoromethyl)phenyl]-2,4-dihydroquinolin-1-yl]phenyl]-2,5-dihydro-1,2,4-oxadiazole-5-carbaldehyde |
| SMILES | CC1(C)Cc2cc(-c3ccc(C(F)(F)F)cc3)ccc2N(c2ccc(C3=NC(C=O)ON3)c(Cl)c2)C1 |
| InChI | InChI=1S/C27H23ClF3N3O2/c1-26(2)13-18-11-17(16-3-6-19(7-4-16)27(29,30)31)5-10-23(18)34(15-26)20-8-9-21(22(28)12-20)25-32-24(14-35)36-33-25/h3-12,14,24H,13,15H2,1-2H3,(H,32,33) |
| InChIKey | AQQAQFYYVCCBSM-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.95 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|